C15H22BrNO5S2 — CID 101001662
[(Z,4S)-2-bromo-5-methyl-4-[(4-methylphenyl)sulfonylamino]hex-2-enyl] methanesulfonate (PubChem CID 101001662) has the molecular formula C15H22BrNO5S2 and a molecular weight of 440.38 g/mol. Its IUPAC name is [(Z,4S)-2-bromo-5-methyl-4-[(4-methylphenyl)sulfonylamino]hex-2-enyl] methanesulfonate.
| Compound Name | [(Z,4S)-2-bromo-5-methyl-4-[(4-methylphenyl)sulfonylamino]hex-2-enyl] methanesulfonate |
|---|---|
| PubChem CID | 101001662 |
| Molecular Formula | C15H22BrNO5S2 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | [(Z,4S)-2-bromo-5-methyl-4-[(4-methylphenyl)sulfonylamino]hex-2-enyl] methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](/C=C(\Br)COS(C)(=O)=O)C(C)C)cc1 |
| InChI | InChI=1S/C15H22BrNO5S2/c1-11(2)15(9-13(16)10-22-23(4,18)19)17-24(20,21)14-7-5-12(3)6-8-14/h5-9,11,15,17H,10H2,1-4H3/b13-9-/t15-/m1/s1 |
| InChIKey | YLLBYEMJLIDWMG-UZGISAJGSA-N |
| XLogP | 2.55 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|