C16H19FN2O3 — CID 170055868
(3Z,7E)-3-ethyl-4-fluoro-1-(6-methylidene-2-oxopiperidin-3-yl)-5,6-dihydroazonine-2,9-dione (PubChem CID 170055868) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is (3Z,7E)-3-ethyl-4-fluoro-1-(6-methylidene-2-oxopiperidin-3-yl)-5,6-dihydroazonine-2,9-dione.
| Compound Name | (3Z,7E)-3-ethyl-4-fluoro-1-(6-methylidene-2-oxopiperidin-3-yl)-5,6-dihydroazonine-2,9-dione |
|---|---|
| PubChem CID | 170055868 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3Z,7E)-3-ethyl-4-fluoro-1-(6-methylidene-2-oxopiperidin-3-yl)-5,6-dihydroazonine-2,9-dione |
| SMILES | C=C1CCC(N2C(=O)/C=C/CC/C(F)=C(\CC)C2=O)C(=O)N1 |
| InChI | InChI=1S/C16H19FN2O3/c1-3-11-12(17)6-4-5-7-14(20)19(16(11)22)13-9-8-10(2)18-15(13)21/h5,7,13H,2-4,6,8-9H2,1H3,(H,18,21)/b7-5+,12-11- |
| InChIKey | AYJLXEMVCXPZRL-JZXHTMOHSA-N |
| XLogP | 2.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|