C26H29FN6O4 — CID 170056085
[(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 170056085) has the molecular formula C26H29FN6O4 and a molecular weight of 508.55 g/mol. Its IUPAC name is [(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 170056085 |
| Molecular Formula | C26H29FN6O4 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@@H]1CC[C@](C#N)(c2ccc3c(NC(=O)CCc4ccc(F)cc4)ncnn23)O1 |
| InChI | InChI=1S/C26H29FN6O4/c1-16(2)23(29)25(35)36-13-19-11-12-26(14-28,37-19)21-9-8-20-24(30-15-31-33(20)21)32-22(34)10-5-17-3-6-18(27)7-4-17/h3-4,6-9,15-16,19,23H,5,10-13,29H2,1-2H3,(H,30,31,32,34)/t19-,23-,26-/m0/s1 |
| InChIKey | JAXDCKMAHBGPPH-CZZAQMAHSA-N |
| XLogP | 2.86 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |