C27H24O3S — CID 170074291
[4-[4-[4-(3-methylbuta-1,3-dien-2-yloxy)-3-sulfanylphenyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 170074291) has the molecular formula C27H24O3S and a molecular weight of 428.55 g/mol. Its IUPAC name is [4-[4-[4-(3-methylbuta-1,3-dien-2-yloxy)-3-sulfanylphenyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-(3-methylbuta-1,3-dien-2-yloxy)-3-sulfanylphenyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170074291 |
| Molecular Formula | C27H24O3S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [4-[4-[4-(3-methylbuta-1,3-dien-2-yloxy)-3-sulfanylphenyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=C)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)cc3)cc2)cc1S |
| InChI | InChI=1S/C27H24O3S/c1-17(2)19(5)29-25-15-12-23(16-26(25)31)22-8-6-20(7-9-22)21-10-13-24(14-11-21)30-27(28)18(3)4/h6-16,31H,1,3,5H2,2,4H3 |
| InChIKey | WOZRXJMTFJEUDW-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|