C13H15IO2S — CID 170084314
[1-(5-iodothiophen-2-yl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 170084314) has the molecular formula C13H15IO2S and a molecular weight of 362.23 g/mol. Its IUPAC name is [1-(5-iodothiophen-2-yl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [1-(5-iodothiophen-2-yl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170084314 |
| Molecular Formula | C13H15IO2S |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | [1-(5-iodothiophen-2-yl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(c2ccc(I)s2)CCCC1 |
| InChI | InChI=1S/C13H15IO2S/c1-9(2)12(15)16-13(7-3-4-8-13)10-5-6-11(14)17-10/h5-6H,1,3-4,7-8H2,2H3 |
| InChIKey | YHDVAVWPODIXEJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|