C28H46N2O5 — CID 170115797
ethyl 2-[(2-ethoxy-2-oxoethyl)-[7-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]heptyl]amino]acetate (PubChem CID 170115797) has the molecular formula C28H46N2O5 and a molecular weight of 490.69 g/mol. Its IUPAC name is ethyl 2-[(2-ethoxy-2-oxoethyl)-[7-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]heptyl]amino]acetate.
| Compound Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-[7-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]heptyl]amino]acetate |
|---|---|
| PubChem CID | 170115797 |
| Molecular Formula | C28H46N2O5 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.34 |
| IUPAC Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-[7-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]heptyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCCCCCCNC(=O)[C@@H](C)c1ccc(CC(C)C)cc1)CC(=O)OCC |
| InChI | InChI=1S/C28H46N2O5/c1-6-34-26(31)20-30(21-27(32)35-7-2)18-12-10-8-9-11-17-29-28(33)23(5)25-15-13-24(14-16-25)19-22(3)4/h13-16,22-23H,6-12,17-21H2,1-5H3,(H,29,33)/t23-/m0/s1 |
| InChIKey | DJSSCMRCFUYXKL-QHCPKHFHSA-N |
| XLogP | 4.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|