C27H31NO3 — CID 170118423
2-[[4-[[3-(2-methylpropyl)phenyl]methoxy]-3-phenylmethoxyphenyl]methylideneamino]ethanol (PubChem CID 170118423) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[[4-[[3-(2-methylpropyl)phenyl]methoxy]-3-phenylmethoxyphenyl]methylideneamino]ethanol.
| Compound Name | 2-[[4-[[3-(2-methylpropyl)phenyl]methoxy]-3-phenylmethoxyphenyl]methylideneamino]ethanol |
|---|---|
| PubChem CID | 170118423 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2-[[4-[[3-(2-methylpropyl)phenyl]methoxy]-3-phenylmethoxyphenyl]methylideneamino]ethanol |
| SMILES | CC(C)Cc1cccc(COc2ccc(/C=N/CCO)cc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H31NO3/c1-21(2)15-23-9-6-10-25(16-23)20-30-26-12-11-24(18-28-13-14-29)17-27(26)31-19-22-7-4-3-5-8-22/h3-12,16-18,21,29H,13-15,19-20H2,1-2H3/b28-18+ |
| InChIKey | FHARFMQIFPZIMC-MTDXEUNCSA-N |
| XLogP | 5.45 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|