C46H91NO7P+ — CID 170128496
2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy-[2-(methylamino)ethoxy]-oxophosphanium (PubChem CID 170128496) has the molecular formula C46H91NO7P+ and a molecular weight of 801.21 g/mol. Its IUPAC name is 2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy-[2-(methylamino)ethoxy]-oxophosphanium.
| Compound Name | 2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy-[2-(methylamino)ethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 170128496 |
| Molecular Formula | C46H91NO7P+ |
| Molecular Weight | 801.21 g/mol |
| Exact Mass | 800.65 |
| IUPAC Name | 2,3-bis(3,7,11,15-tetramethylhexadecanoyloxy)propoxy-[2-(methylamino)ethoxy]-oxophosphanium |
| SMILES | CNCCO[P+](=O)OCC(COC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C)OC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C46H91NO7P/c1-36(2)18-12-20-38(5)22-14-24-40(7)26-16-28-42(9)32-45(48)51-34-44(35-53-55(50)52-31-30-47-11)54-46(49)33-43(10)29-17-27-41(8)25-15-23-39(6)21-13-19-37(3)4/h36-44,47H,12-35H2,1-11H3/q+1 |
| InChIKey | DHUUKPKZQYLTCD-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.21 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|