C22H30S — CID 170136237
2,7-ditert-butyl-5,5-dimethyldibenzothiophene (PubChem CID 170136237) has the molecular formula C22H30S and a molecular weight of 326.55 g/mol. Its IUPAC name is 2,7-ditert-butyl-5,5-dimethyldibenzothiophene.
| Compound Name | 2,7-ditert-butyl-5,5-dimethyldibenzothiophene |
|---|---|
| PubChem CID | 170136237 |
| Molecular Formula | C22H30S |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2,7-ditert-butyl-5,5-dimethyldibenzothiophene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1ccc(C(C)(C)C)cc1S2(C)C |
| InChI | InChI=1S/C22H30S/c1-21(2,3)15-10-12-19-18(13-15)17-11-9-16(22(4,5)6)14-20(17)23(19,7)8/h9-14H,1-8H3 |
| InChIKey | HMPZJEQWSWJPHV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |