C25H30 — CID 163303664
3,6-ditert-butyl-9-(2-methylprop-1-enylidene)fluorene (PubChem CID 163303664) has the molecular formula C25H30 and a molecular weight of 330.52 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-(2-methylprop-1-enylidene)fluorene.
| Compound Name | 3,6-ditert-butyl-9-(2-methylprop-1-enylidene)fluorene |
|---|---|
| PubChem CID | 163303664 |
| Molecular Formula | C25H30 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 3,6-ditert-butyl-9-(2-methylprop-1-enylidene)fluorene |
| SMILES | CC(C)=C=C1c2ccc(C(C)(C)C)cc2-c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C25H30/c1-16(2)13-21-19-11-9-17(24(3,4)5)14-22(19)23-15-18(25(6,7)8)10-12-20(21)23/h9-12,14-15H,1-8H3 |
| InChIKey | AVSWKEBEIRRCTE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |