C22H26S2 — CID 86018504
2,7-ditert-butyl-9H-fluorene-9-carbodithioic acid (PubChem CID 86018504) has the molecular formula C22H26S2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 2,7-ditert-butyl-9H-fluorene-9-carbodithioic acid.
| Compound Name | 2,7-ditert-butyl-9H-fluorene-9-carbodithioic acid |
|---|---|
| PubChem CID | 86018504 |
| Molecular Formula | C22H26S2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2,7-ditert-butyl-9H-fluorene-9-carbodithioic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C(=S)S)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C22H26S2/c1-21(2,3)13-7-9-15-16-10-8-14(22(4,5)6)12-18(16)19(20(23)24)17(15)11-13/h7-12,19H,1-6H3,(H,23,24) |
| InChIKey | OHGFIGADJCREHN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|