C20H26Si — CID 101350159
3,7-ditert-butyl-5H-benzo[b][1]benzosilole (PubChem CID 101350159) has the molecular formula C20H26Si and a molecular weight of 294.51 g/mol. Its IUPAC name is 3,7-ditert-butyl-5H-benzo[b][1]benzosilole.
| Compound Name | 3,7-ditert-butyl-5H-benzo[b][1]benzosilole |
|---|---|
| PubChem CID | 101350159 |
| Molecular Formula | C20H26Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3,7-ditert-butyl-5H-benzo[b][1]benzosilole |
| SMILES | CC(C)(C)c1ccc2c(c1)[SiH2]c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C20H26Si/c1-19(2,3)13-7-9-15-16-10-8-14(20(4,5)6)12-18(16)21-17(15)11-13/h7-12H,21H2,1-6H3 |
| InChIKey | CXTBRFZHXDPYLQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|