C11H20F3N — CID 170144257
3-hexan-2-yl-1-(2,2,2-trifluoroethyl)azetidine (PubChem CID 170144257) has the molecular formula C11H20F3N and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-hexan-2-yl-1-(2,2,2-trifluoroethyl)azetidine.
| Compound Name | 3-hexan-2-yl-1-(2,2,2-trifluoroethyl)azetidine |
|---|---|
| PubChem CID | 170144257 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 3-hexan-2-yl-1-(2,2,2-trifluoroethyl)azetidine |
| SMILES | CCCCC(C)C1CN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3N/c1-3-4-5-9(2)10-6-15(7-10)8-11(12,13)14/h9-10H,3-8H2,1-2H3 |
| InChIKey | VUAHSFYNTBFNAB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |