C12H13F3O — CID 170148397
1,1,1-trifluoro-2-(2-prop-2-enylphenyl)propan-2-ol (PubChem CID 170148397) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2-prop-2-enylphenyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(2-prop-2-enylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 170148397 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1,1,1-trifluoro-2-(2-prop-2-enylphenyl)propan-2-ol |
| SMILES | C=CCc1ccccc1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O/c1-3-6-9-7-4-5-8-10(9)11(2,16)12(13,14)15/h3-5,7-8,16H,1,6H2,2H3 |
| InChIKey | WQRXVRZFEJTQFP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|