C33H39FN4O5S — CID 170150424
N-[(2S)-4-[[(1S,2R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]-4-(4-formylphenyl)benzamide (PubChem CID 170150424) has the molecular formula C33H39FN4O5S and a molecular weight of 622.76 g/mol. Its IUPAC name is N-[(2S)-4-[[(1S,2R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]-4-(4-formylphenyl)benzamide.
| Compound Name | N-[(2S)-4-[[(1S,2R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]-4-(4-formylphenyl)benzamide |
|---|---|
| PubChem CID | 170150424 |
| Molecular Formula | C33H39FN4O5S |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | N-[(2S)-4-[[(1S,2R)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]-4-(4-formylphenyl)benzamide |
| SMILES | C=C(/C=C\C(F)=C/C)[C@H]1C[C@@H]1NCC[C@H](NC(=O)c1ccc(-c2ccc(C=O)cc2)cc1)C(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C33H39FN4O5S/c1-4-28(34)14-5-23(2)29-21-31(29)35-16-15-30(33(41)37-17-19-38(20-18-37)44(3,42)43)36-32(40)27-12-10-26(11-13-27)25-8-6-24(22-39)7-9-25/h4-14,22,29-31,35H,2,15-21H2,1,3H3,(H,36,40)/b14-5-,28-4+/t29-,30+,31+/m1/s1 |
| InChIKey | RJXFQZAKFAZECW-CKGYHYNRSA-N |
| XLogP | 3.72 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|