C13H24N8O2 — CID 170151658
N-[6-[[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylamino]hexyl]acetamide (PubChem CID 170151658) has the molecular formula C13H24N8O2 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[6-[[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylamino]hexyl]acetamide.
| Compound Name | N-[6-[[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylamino]hexyl]acetamide |
|---|---|
| PubChem CID | 170151658 |
| Molecular Formula | C13H24N8O2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[6-[[4-amino-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylamino]hexyl]acetamide |
| SMILES | CNc1nc(N)nc(NC(=O)NCCCCCCNC(C)=O)n1 |
| InChI | InChI=1S/C13H24N8O2/c1-9(22)16-7-5-3-4-6-8-17-13(23)21-12-19-10(14)18-11(15-2)20-12/h3-8H2,1-2H3,(H,16,22)(H5,14,15,17,18,19,20,21,23) |
| InChIKey | YPHMQFMHSDYGEA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|