C18H28N2O4 — CID 170156478
[3-[(2,4-dimethoxyphenyl)methylamino]cyclobutyl] N-tert-butylcarbamate (PubChem CID 170156478) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is [3-[(2,4-dimethoxyphenyl)methylamino]cyclobutyl] N-tert-butylcarbamate.
| Compound Name | [3-[(2,4-dimethoxyphenyl)methylamino]cyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170156478 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [3-[(2,4-dimethoxyphenyl)methylamino]cyclobutyl] N-tert-butylcarbamate |
| SMILES | COc1ccc(CNC2CC(OC(=O)NC(C)(C)C)C2)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-18(2,3)20-17(21)24-15-8-13(9-15)19-11-12-6-7-14(22-4)10-16(12)23-5/h6-7,10,13,15,19H,8-9,11H2,1-5H3,(H,20,21) |
| InChIKey | OJNCJGLZRCSBJK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |