C13H10ClN3O5 — CID 170161171
3-(5-chloro-7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 170161171) has the molecular formula C13H10ClN3O5 and a molecular weight of 323.69 g/mol. Its IUPAC name is 3-(5-chloro-7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-chloro-7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170161171 |
| Molecular Formula | C13H10ClN3O5 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3-(5-chloro-7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(Cl)cc3[N+](=O)[O-])C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10ClN3O5/c14-6-3-7-8(10(4-6)17(21)22)5-16(13(7)20)9-1-2-11(18)15-12(9)19/h3-4,9H,1-2,5H2,(H,15,18,19) |
| InChIKey | GVAUQYZBSJQKRF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|