C13H10ClN3O4 — CID 10063842
(6aS)-2-chloro-8-methylidene-4-nitro-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 10063842) has the molecular formula C13H10ClN3O4 and a molecular weight of 307.69 g/mol. Its IUPAC name is (6aS)-2-chloro-8-methylidene-4-nitro-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS)-2-chloro-8-methylidene-4-nitro-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 10063842 |
| Molecular Formula | C13H10ClN3O4 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (6aS)-2-chloro-8-methylidene-4-nitro-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | C=C1C[C@H]2C(=O)Nc3c(cc(Cl)cc3[N+](=O)[O-])C(=O)N2C1 |
| InChI | InChI=1S/C13H10ClN3O4/c1-6-2-10-12(18)15-11-8(13(19)16(10)5-6)3-7(14)4-9(11)17(20)21/h3-4,10H,1-2,5H2,(H,15,18)/t10-/m0/s1 |
| InChIKey | RWBBXKRRPQJPKX-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|