C15H12O4 — CID 170173092
6-[2-(4-methoxyphenyl)ethynyl]benzene-1,2,4-triol (PubChem CID 170173092) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenyl)ethynyl]benzene-1,2,4-triol.
| Compound Name | 6-[2-(4-methoxyphenyl)ethynyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 170173092 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 6-[2-(4-methoxyphenyl)ethynyl]benzene-1,2,4-triol |
| SMILES | COc1ccc(C#Cc2cc(O)cc(O)c2O)cc1 |
| InChI | InChI=1S/C15H12O4/c1-19-13-6-3-10(4-7-13)2-5-11-8-12(16)9-14(17)15(11)18/h3-4,6-9,16-18H,1H3 |
| InChIKey | YHCGFYMWYLPHOZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|