C14H13Cl2N — CID 170184256
2-(3,5-dichlorophenyl)-N,6-dimethylaniline (PubChem CID 170184256) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-N,6-dimethylaniline.
| Compound Name | 2-(3,5-dichlorophenyl)-N,6-dimethylaniline |
|---|---|
| PubChem CID | 170184256 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-N,6-dimethylaniline |
| SMILES | CNc1c(C)cccc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N/c1-9-4-3-5-13(14(9)17-2)10-6-11(15)8-12(16)7-10/h3-8,17H,1-2H3 |
| InChIKey | PIWWPWNRMVJWHH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |