C17H28O6 — CID 170189335
4-methyl-3-[3-(2-methylprop-2-enoyloxy)propoxycarbonyl]-2-propan-2-ylpentanoic acid (PubChem CID 170189335) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-methyl-3-[3-(2-methylprop-2-enoyloxy)propoxycarbonyl]-2-propan-2-ylpentanoic acid.
| Compound Name | 4-methyl-3-[3-(2-methylprop-2-enoyloxy)propoxycarbonyl]-2-propan-2-ylpentanoic acid |
|---|---|
| PubChem CID | 170189335 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-methyl-3-[3-(2-methylprop-2-enoyloxy)propoxycarbonyl]-2-propan-2-ylpentanoic acid |
| SMILES | C=C(C)C(=O)OCCCOC(=O)C(C(C)C)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C17H28O6/c1-10(2)13(15(18)19)14(11(3)4)17(21)23-9-7-8-22-16(20)12(5)6/h10-11,13-14H,5,7-9H2,1-4,6H3,(H,18,19) |
| InChIKey | NTFNAQWYVGBRKR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|