C33H65NO6S — CID 170189691
2-ethylbutyl 9-[[9-(2-ethylbutoxy)-2-hydroxy-9-oxononyl]-(3-sulfanylpropyl)amino]-8-hydroxynonanoate (PubChem CID 170189691) has the molecular formula C33H65NO6S and a molecular weight of 603.95 g/mol. Its IUPAC name is 2-ethylbutyl 9-[[9-(2-ethylbutoxy)-2-hydroxy-9-oxononyl]-(3-sulfanylpropyl)amino]-8-hydroxynonanoate.
| Compound Name | 2-ethylbutyl 9-[[9-(2-ethylbutoxy)-2-hydroxy-9-oxononyl]-(3-sulfanylpropyl)amino]-8-hydroxynonanoate |
|---|---|
| PubChem CID | 170189691 |
| Molecular Formula | C33H65NO6S |
| Molecular Weight | 603.95 g/mol |
| Exact Mass | 603.45 |
| IUPAC Name | 2-ethylbutyl 9-[[9-(2-ethylbutoxy)-2-hydroxy-9-oxononyl]-(3-sulfanylpropyl)amino]-8-hydroxynonanoate |
| SMILES | CCC(CC)COC(=O)CCCCCCC(O)CN(CCCS)CC(O)CCCCCCC(=O)OCC(CC)CC |
| InChI | InChI=1S/C33H65NO6S/c1-5-28(6-2)26-39-32(37)20-15-11-9-13-18-30(35)24-34(22-17-23-41)25-31(36)19-14-10-12-16-21-33(38)40-27-29(7-3)8-4/h28-31,35-36,41H,5-27H2,1-4H3 |
| InChIKey | CSTWWKPOEKJKOE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.95 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|