C23H21F6N3O2S2 — CID 170190536
2-[[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]sulfanylamino]-4-(trifluoromethyl)-N-[3-(trifluoromethyl)cyclobut-2-en-1-yl]benzamide (PubChem CID 170190536) has the molecular formula C23H21F6N3O2S2 and a molecular weight of 549.56 g/mol. Its IUPAC name is 2-[[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]sulfanylamino]-4-(trifluoromethyl)-N-[3-(trifluoromethyl)cyclobut-2-en-1-yl]benzamide.
| Compound Name | 2-[[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]sulfanylamino]-4-(trifluoromethyl)-N-[3-(trifluoromethyl)cyclobut-2-en-1-yl]benzamide |
|---|---|
| PubChem CID | 170190536 |
| Molecular Formula | C23H21F6N3O2S2 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 2-[[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]sulfanylamino]-4-(trifluoromethyl)-N-[3-(trifluoromethyl)cyclobut-2-en-1-yl]benzamide |
| SMILES | O=C(NC1C=C(C(F)(F)F)C1)c1ccc(C(F)(F)F)cc1NSc1ccc(N2CCS(=O)CC2)cc1 |
| InChI | InChI=1S/C23H21F6N3O2S2/c24-22(25,26)14-1-6-19(21(33)30-16-11-15(12-16)23(27,28)29)20(13-14)31-35-18-4-2-17(3-5-18)32-7-9-36(34)10-8-32/h1-6,11,13,16,31H,7-10,12H2,(H,30,33) |
| InChIKey | RWQXALWUCGYBEO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|