C20H25F4N3O2S2 — CID 170190893
4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfanylamino]-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide (PubChem CID 170190893) has the molecular formula C20H25F4N3O2S2 and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfanylamino]-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide.
| Compound Name | 4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfanylamino]-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide |
|---|---|
| PubChem CID | 170190893 |
| Molecular Formula | C20H25F4N3O2S2 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfanylamino]-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide |
| SMILES | O=C(NC12CCC(C(F)(F)F)(CC1)CC2)c1ccc(F)cc1NSN1CCS(=O)CC1 |
| InChI | InChI=1S/C20H25F4N3O2S2/c21-14-1-2-15(16(13-14)26-30-27-9-11-31(29)12-10-27)17(28)25-19-6-3-18(4-7-19,5-8-19)20(22,23)24/h1-2,13,26H,3-12H2,(H,25,28) |
| InChIKey | VTLNOLPGIFQJEL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|