C8H13Cl — CID 170198922
(4Z)-3-(2-chloroethyl)hexa-1,4-diene (PubChem CID 170198922) has the molecular formula C8H13Cl and a molecular weight of 144.64 g/mol. Its IUPAC name is (4Z)-3-(2-chloroethyl)hexa-1,4-diene.
| Compound Name | (4Z)-3-(2-chloroethyl)hexa-1,4-diene |
|---|---|
| PubChem CID | 170198922 |
| Molecular Formula | C8H13Cl |
| Molecular Weight | 144.64 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | (4Z)-3-(2-chloroethyl)hexa-1,4-diene |
| SMILES | C=CC(/C=C\C)CCCl |
| InChI | InChI=1S/C8H13Cl/c1-3-5-8(4-2)6-7-9/h3-5,8H,2,6-7H2,1H3/b5-3- |
| InChIKey | SECHWBRUKWCOQF-HYXAFXHYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|