C16H14Cl2N4O6S — CID 17020212
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetate (PubChem CID 17020212) has the molecular formula C16H14Cl2N4O6S and a molecular weight of 461.28 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 17020212 |
| Molecular Formula | C16H14Cl2N4O6S |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)O/N=C(\N)c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2N4O6S/c1-21(29(26,27)14-8-11(17)4-7-13(14)18)9-15(23)28-20-16(19)10-2-5-12(6-3-10)22(24)25/h2-8H,9H2,1H3,(H2,19,20) |
| InChIKey | ZYGNKWSBPPQBGV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|