C27H27F3N6O3 — CID 170204930
3-[[6-[[4-(4-propanoylpiperazin-1-yl)phenyl]methylamino]pyridazin-3-yl]oxymethyl]-5-(trifluoromethoxy)benzonitrile (PubChem CID 170204930) has the molecular formula C27H27F3N6O3 and a molecular weight of 540.55 g/mol. Its IUPAC name is 3-[[6-[[4-(4-propanoylpiperazin-1-yl)phenyl]methylamino]pyridazin-3-yl]oxymethyl]-5-(trifluoromethoxy)benzonitrile.
| Compound Name | 3-[[6-[[4-(4-propanoylpiperazin-1-yl)phenyl]methylamino]pyridazin-3-yl]oxymethyl]-5-(trifluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 170204930 |
| Molecular Formula | C27H27F3N6O3 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 3-[[6-[[4-(4-propanoylpiperazin-1-yl)phenyl]methylamino]pyridazin-3-yl]oxymethyl]-5-(trifluoromethoxy)benzonitrile |
| SMILES | CCC(=O)N1CCN(c2ccc(CNc3ccc(OCc4cc(C#N)cc(OC(F)(F)F)c4)nn3)cc2)CC1 |
| InChI | InChI=1S/C27H27F3N6O3/c1-2-26(37)36-11-9-35(10-12-36)22-5-3-19(4-6-22)17-32-24-7-8-25(34-33-24)38-18-21-13-20(16-31)14-23(15-21)39-27(28,29)30/h3-8,13-15H,2,9-12,17-18H2,1H3,(H,32,33) |
| InChIKey | YATXYKHRFUJZSD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|