C14H14NS+ — CID 170219470
2-propyl-[1]benzothiolo[2,3-c]pyridin-2-ium (PubChem CID 170219470) has the molecular formula C14H14NS+ and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-propyl-[1]benzothiolo[2,3-c]pyridin-2-ium.
| Compound Name | 2-propyl-[1]benzothiolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 170219470 |
| Molecular Formula | C14H14NS+ |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-propyl-[1]benzothiolo[2,3-c]pyridin-2-ium |
| SMILES | CCC[n+]1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C14H14NS/c1-2-8-15-9-7-12-11-5-3-4-6-13(11)16-14(12)10-15/h3-7,9-10H,2,8H2,1H3/q+1 |
| InChIKey | KJBJUQSFSLBPEX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|