C17H21NO4S — CID 170222460
2-[2-[1-[(2-methyloxiran-2-yl)methoxy]propan-2-ylsulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 170222460) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-[2-[1-[(2-methyloxiran-2-yl)methoxy]propan-2-ylsulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-[(2-methyloxiran-2-yl)methoxy]propan-2-ylsulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170222460 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[2-[1-[(2-methyloxiran-2-yl)methoxy]propan-2-ylsulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | CC(COCC1(C)CO1)SCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H21NO4S/c1-12(9-21-10-17(2)11-22-17)23-8-7-18-15(19)13-5-3-4-6-14(13)16(18)20/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | VGNSDQJKZQEMHD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|