C23H28N4O3 — CID 170222843
(3R)-1-[(8S,10aR)-2-acetyl-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile (PubChem CID 170222843) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (3R)-1-[(8S,10aR)-2-acetyl-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile.
| Compound Name | (3R)-1-[(8S,10aR)-2-acetyl-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 170222843 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (3R)-1-[(8S,10aR)-2-acetyl-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
| SMILES | CC(=O)N1CCCC(=O)N2[C@H](CC[C@H]2C(=O)N2CC(c3ccccc3)[C@@H](C#N)C2)C1 |
| InChI | InChI=1S/C23H28N4O3/c1-16(28)25-11-5-8-22(29)27-19(14-25)9-10-21(27)23(30)26-13-18(12-24)20(15-26)17-6-3-2-4-7-17/h2-4,6-7,18-21H,5,8-11,13-15H2,1H3/t18-,19+,20?,21-/m0/s1 |
| InChIKey | BHLFEBNZMNWRDQ-JKWVGCSGSA-N |
| XLogP | 1.75 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |