C24H31N5O2 — CID 178077602
(3S,4R)-1-[(1R,2R,8S,11S)-8-amino-4-methyl-9-oxo-4,10-diazatricyclo[8.3.0.02,6]tridecane-11-carbonyl]-4-phenylpyrrolidine-3-carbonitrile (PubChem CID 178077602) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (3S,4R)-1-[(1R,2R,8S,11S)-8-amino-4-methyl-9-oxo-4,10-diazatricyclo[8.3.0.02,6]tridecane-11-carbonyl]-4-phenylpyrrolidine-3-carbonitrile.
| Compound Name | (3S,4R)-1-[(1R,2R,8S,11S)-8-amino-4-methyl-9-oxo-4,10-diazatricyclo[8.3.0.02,6]tridecane-11-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 178077602 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (3S,4R)-1-[(1R,2R,8S,11S)-8-amino-4-methyl-9-oxo-4,10-diazatricyclo[8.3.0.02,6]tridecane-11-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
| SMILES | CN1CC2C[C@H](N)C(=O)N3[C@H](CC[C@H]3C(=O)N3C[C@@H](C#N)[C@H](c4ccccc4)C3)[C@H]2C1 |
| InChI | InChI=1S/C24H31N5O2/c1-27-11-16-9-20(26)23(30)29-21(19(16)13-27)7-8-22(29)24(31)28-12-17(10-25)18(14-28)15-5-3-2-4-6-15/h2-6,16-22H,7-9,11-14,26H2,1H3/t16?,17-,18+,19+,20+,21-,22+/m1/s1 |
| InChIKey | WGKCMAGQQYVCIB-CWJYDBMESA-N |
| XLogP | 1.02 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |