C21H26N4O3S — CID 176768485
(3S,4R)-1-[(5R,8S,10aR)-5-amino-3,6-dioxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[2,1-d][1,5]thiazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile (PubChem CID 176768485) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is (3S,4R)-1-[(5R,8S,10aR)-5-amino-3,6-dioxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[2,1-d][1,5]thiazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile.
| Compound Name | (3S,4R)-1-[(5R,8S,10aR)-5-amino-3,6-dioxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[2,1-d][1,5]thiazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 176768485 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (3S,4R)-1-[(5R,8S,10aR)-5-amino-3,6-dioxo-1,2,4,5,8,9,10,10a-octahydropyrrolo[2,1-d][1,5]thiazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
| SMILES | N#C[C@@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCS(=O)C[C@H](N)C(=O)N32)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H26N4O3S/c22-10-15-11-24(12-17(15)14-4-2-1-3-5-14)21(27)19-7-6-16-8-9-29(28)13-18(23)20(26)25(16)19/h1-5,15-19H,6-9,11-13,23H2/t15-,16-,17+,18+,19+,29?/m1/s1 |
| InChIKey | KJCFWBGYKYLUCM-POHFYFLSSA-N |
| XLogP | 0.59 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |