C23H29N5O3 — CID 176768492
(3R,4S)-1-[(5S,8S,10aR)-2-acetyl-5-amino-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile (PubChem CID 176768492) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is (3R,4S)-1-[(5S,8S,10aR)-2-acetyl-5-amino-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile.
| Compound Name | (3R,4S)-1-[(5S,8S,10aR)-2-acetyl-5-amino-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 176768492 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (3R,4S)-1-[(5S,8S,10aR)-2-acetyl-5-amino-6-oxo-1,3,4,5,8,9,10,10a-octahydropyrrolo[1,2-a][1,4]diazocine-8-carbonyl]-4-phenylpyrrolidine-3-carbonitrile |
| SMILES | CC(=O)N1CC[C@H](N)C(=O)N2[C@H](CC[C@H]2C(=O)N2C[C@H](c3ccccc3)[C@@H](C#N)C2)C1 |
| InChI | InChI=1S/C23H29N5O3/c1-15(29)26-10-9-20(25)22(30)28-18(13-26)7-8-21(28)23(31)27-12-17(11-24)19(14-27)16-5-3-2-4-6-16/h2-6,17-21H,7-10,12-14,25H2,1H3/t17-,18+,19+,20-,21-/m0/s1 |
| InChIKey | FZVHNGKXYGQGRA-ZPAWYTMASA-N |
| XLogP | 0.69 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |