C53H47N3 — CID 170227973
2-[9-[(2Z,4Z)-hepta-2,4-dienyl]-9-phenyl-4b,8a-dihydrofluoren-4-yl]-6-(5-phenylcyclohexa-2,4-dien-1-yl)-4-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 170227973) has the molecular formula C53H47N3 and a molecular weight of 725.98 g/mol. Its IUPAC name is 2-[9-[(2Z,4Z)-hepta-2,4-dienyl]-9-phenyl-4b,8a-dihydrofluoren-4-yl]-6-(5-phenylcyclohexa-2,4-dien-1-yl)-4-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[9-[(2Z,4Z)-hepta-2,4-dienyl]-9-phenyl-4b,8a-dihydrofluoren-4-yl]-6-(5-phenylcyclohexa-2,4-dien-1-yl)-4-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 170227973 |
| Molecular Formula | C53H47N3 |
| Molecular Weight | 725.98 g/mol |
| Exact Mass | 725.38 |
| IUPAC Name | 2-[9-[(2Z,4Z)-hepta-2,4-dienyl]-9-phenyl-4b,8a-dihydrofluoren-4-yl]-6-(5-phenylcyclohexa-2,4-dien-1-yl)-4-(3-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | CC/C=C\C=C/CC1(c2ccccc2)c2cccc(C3=NC(c4cccc(-c5ccccc5)c4)N=C(C4C=CC=C(c5ccccc5)C4)N3)c2C2C=CC=CC21 |
| InChI | InChI=1S/C53H47N3/c1-2-3-4-5-17-35-53(44-29-13-8-14-30-44)47-33-16-15-31-45(47)49-46(32-20-34-48(49)53)52-55-50(42-27-18-25-40(36-42)38-21-9-6-10-22-38)54-51(56-52)43-28-19-26-41(37-43)39-23-11-7-12-24-39/h3-34,36,43,45,47,50H,2,35,37H2,1H3,(H,54,55,56)/b4-3-,17-5- |
| InChIKey | GBAZJBXHNPREAK-AFLZKEFTSA-N |
| XLogP | 12.50 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.98 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|