C28H27N — CID 170230016
5-tert-butyl-15-methyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene (PubChem CID 170230016) has the molecular formula C28H27N and a molecular weight of 377.53 g/mol. Its IUPAC name is 5-tert-butyl-15-methyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene.
| Compound Name | 5-tert-butyl-15-methyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 170230016 |
| Molecular Formula | C28H27N |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 5-tert-butyl-15-methyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
| SMILES | C=c1c2c(C)cccc2n2c3ccc(C(C)(C)C)cc3c3ccc(/C=C\C)c1c32 |
| InChI | InChI=1S/C28H27N/c1-7-9-19-12-14-21-22-16-20(28(4,5)6)13-15-23(22)29-24-11-8-10-17(2)25(24)18(3)26(19)27(21)29/h7-16H,3H2,1-2,4-6H3/b9-7- |
| InChIKey | DTKARMLJJOQLDY-CLFYSBASSA-N |
| XLogP | 7.17 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|