C23H20F2N4O2 — CID 170234384
6-(difluoromethyl)-N-[(Z)-2-hydroxy-3-phenylprop-1-enyl]-N-methyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-3-carboxamide (PubChem CID 170234384) has the molecular formula C23H20F2N4O2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 6-(difluoromethyl)-N-[(Z)-2-hydroxy-3-phenylprop-1-enyl]-N-methyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-3-carboxamide.
| Compound Name | 6-(difluoromethyl)-N-[(Z)-2-hydroxy-3-phenylprop-1-enyl]-N-methyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170234384 |
| Molecular Formula | C23H20F2N4O2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 6-(difluoromethyl)-N-[(Z)-2-hydroxy-3-phenylprop-1-enyl]-N-methyl-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-3-carboxamide |
| SMILES | CN(/C=C(\O)Cc1ccccc1)C(=O)c1cnc(C(F)F)c(C#Cc2cnn(C)c2)c1 |
| InChI | InChI=1S/C23H20F2N4O2/c1-28(15-20(30)10-16-6-4-3-5-7-16)23(31)19-11-18(21(22(24)25)26-13-19)9-8-17-12-27-29(2)14-17/h3-7,11-15,22,30H,10H2,1-2H3/b20-15- |
| InChIKey | AJVJSWUDAHVYDK-HKWRFOASSA-N |
| XLogP | 3.87 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|