C18H20N6 — CID 170246696
(1R,2S,13R,14R)-13-(5-methyl-1H-pyrazol-4-yl)-6,7,9,12-tetrazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraene (PubChem CID 170246696) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is (1R,2S,13R,14R)-13-(5-methyl-1H-pyrazol-4-yl)-6,7,9,12-tetrazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraene.
| Compound Name | (1R,2S,13R,14R)-13-(5-methyl-1H-pyrazol-4-yl)-6,7,9,12-tetrazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraene |
|---|---|
| PubChem CID | 170246696 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (1R,2S,13R,14R)-13-(5-methyl-1H-pyrazol-4-yl)-6,7,9,12-tetrazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraene |
| SMILES | Cc1[nH]ncc1[C@@H]1Nc2cnc3[nH]ncc3c2[C@H]2[C@@H]3CCC(C3)[C@H]21 |
| InChI | InChI=1S/C18H20N6/c1-8-11(5-20-23-8)17-15-10-3-2-9(4-10)14(15)16-12-6-21-24-18(12)19-7-13(16)22-17/h5-7,9-10,14-15,17,22H,2-4H2,1H3,(H,20,23)(H,19,21,24)/t9-,10?,14+,15-,17+/m1/s1 |
| InChIKey | NOVZFPNPLBQAFF-RIVCRSOJSA-N |
| XLogP | 3.29 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |