C15H12FNO3 — CID 170275297
5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)indene-1,3-dione (PubChem CID 170275297) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is 5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)indene-1,3-dione.
| Compound Name | 5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 170275297 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)indene-1,3-dione |
| SMILES | C=C1CCC(C2C(=O)c3ccc(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H12FNO3/c1-7-2-4-10(15(20)17-7)12-13(18)9-5-3-8(16)6-11(9)14(12)19/h3,5-6,10,12H,1-2,4H2,(H,17,20) |
| InChIKey | OMVSPYRLCNGHRL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|