C22H21NO3 — CID 167644004
2-(6-methylidene-2-oxopiperidin-3-yl)-6-propan-2-ylphenalene-1,3-dione (PubChem CID 167644004) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-6-propan-2-ylphenalene-1,3-dione.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-6-propan-2-ylphenalene-1,3-dione |
|---|---|
| PubChem CID | 167644004 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-6-propan-2-ylphenalene-1,3-dione |
| SMILES | C=C1CCC(C2C(=O)c3cccc4c(C(C)C)ccc(c34)C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H21NO3/c1-11(2)13-9-10-16-18-14(13)5-4-6-15(18)20(24)19(21(16)25)17-8-7-12(3)23-22(17)26/h4-6,9-11,17,19H,3,7-8H2,1-2H3,(H,23,26) |
| InChIKey | MQTFREBSBQPZDA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|