C31H52N8O6 — CID 170275623
[4-[[(2S)-6-amino-2-[[(2S)-2-[[4-(3-azido-3-methylbutoxy)-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]phenyl]methyl N-methylcarbamate (PubChem CID 170275623) has the molecular formula C31H52N8O6 and a molecular weight of 632.81 g/mol. Its IUPAC name is [4-[[(2S)-6-amino-2-[[(2S)-2-[[4-(3-azido-3-methylbutoxy)-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [4-[[(2S)-6-amino-2-[[(2S)-2-[[4-(3-azido-3-methylbutoxy)-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 170275623 |
| Molecular Formula | C31H52N8O6 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.40 |
| IUPAC Name | [4-[[(2S)-6-amino-2-[[(2S)-2-[[4-(3-azido-3-methylbutoxy)-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccc(NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)CCC(C)(C)OCCC(C)(C)N=[N+]=[N-])C(C)C)cc1 |
| InChI | InChI=1S/C31H52N8O6/c1-21(2)26(37-25(40)15-16-31(5,6)45-19-17-30(3,4)38-39-33)28(42)36-24(10-8-9-18-32)27(41)35-23-13-11-22(12-14-23)20-44-29(43)34-7/h11-14,21,24,26H,8-10,15-20,32H2,1-7H3,(H,34,43)(H,35,41)(H,36,42)(H,37,40)/t24-,26-/m0/s1 |
| InChIKey | KWJZSKZYWMALTA-AHWVRZQESA-N |
| XLogP | 4.29 |
| TPSA | 209.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|