C32H56N6O6 — CID 144829350
[4-[[(2S)-5-(aminomethylamino)-2-[[(2S)-2-[[4-(3-amino-3-methylbutoxy)-4-methylhexanoyl]amino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate (PubChem CID 144829350) has the molecular formula C32H56N6O6 and a molecular weight of 620.84 g/mol. Its IUPAC name is [4-[[(2S)-5-(aminomethylamino)-2-[[(2S)-2-[[4-(3-amino-3-methylbutoxy)-4-methylhexanoyl]amino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2S)-5-(aminomethylamino)-2-[[(2S)-2-[[4-(3-amino-3-methylbutoxy)-4-methylhexanoyl]amino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 144829350 |
| Molecular Formula | C32H56N6O6 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | [4-[[(2S)-5-(aminomethylamino)-2-[[(2S)-2-[[4-(3-amino-3-methylbutoxy)-4-methylhexanoyl]amino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CCC(C)(CCC(=O)N[C@H](C(=O)N[C@@H](CCCNCN)C(=O)Nc1ccc(COC(C)=O)cc1)C(C)C)OCCC(C)(C)N |
| InChI | InChI=1S/C32H56N6O6/c1-8-32(7,44-19-17-31(5,6)34)16-15-27(40)38-28(22(2)3)30(42)37-26(10-9-18-35-21-33)29(41)36-25-13-11-24(12-14-25)20-43-23(4)39/h11-14,22,26,28,35H,8-10,15-21,33-34H2,1-7H3,(H,36,41)(H,37,42)(H,38,40)/t26-,28-,32?/m0/s1 |
| InChIKey | UCXVAWKRFVPVBS-SXNBFZGNSA-N |
| XLogP | 2.69 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|