C33H46N2S — CID 170289944
(2Z,4E,9E,11E,13E)-13-(1-hexyl-3,3-dimethylindol-2-ylidene)-7,7-dimethyl-6-methylidene-8-methyliminotrideca-2,4,9,11-tetraene-4-thiol (PubChem CID 170289944) has the molecular formula C33H46N2S and a molecular weight of 502.81 g/mol. Its IUPAC name is (2Z,4E,9E,11E,13E)-13-(1-hexyl-3,3-dimethylindol-2-ylidene)-7,7-dimethyl-6-methylidene-8-methyliminotrideca-2,4,9,11-tetraene-4-thiol.
| Compound Name | (2Z,4E,9E,11E,13E)-13-(1-hexyl-3,3-dimethylindol-2-ylidene)-7,7-dimethyl-6-methylidene-8-methyliminotrideca-2,4,9,11-tetraene-4-thiol |
|---|---|
| PubChem CID | 170289944 |
| Molecular Formula | C33H46N2S |
| Molecular Weight | 502.81 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | (2Z,4E,9E,11E,13E)-13-(1-hexyl-3,3-dimethylindol-2-ylidene)-7,7-dimethyl-6-methylidene-8-methyliminotrideca-2,4,9,11-tetraene-4-thiol |
| SMILES | C=C(/C=C(S)\C=C/C)C(C)(C)C(/C=C/C=C/C=C1/N(CCCCCC)c2ccccc2C1(C)C)=N\C |
| InChI | InChI=1S/C33H46N2S/c1-9-11-12-18-24-35-29-21-17-16-20-28(29)33(6,7)31(35)23-15-13-14-22-30(34-8)32(4,5)26(3)25-27(36)19-10-2/h10,13-17,19-23,25,36H,3,9,11-12,18,24H2,1-2,4-8H3/b15-13+,19-10-,22-14+,27-25+,31-23+,34-30- |
| InChIKey | BWHDHMIKCDAIMS-XTKFNTIRSA-N |
| XLogP | 9.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.81 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|