C8H17IN2 — CID 170290356
(2S,5R)-2-ethyl-1-iodo-4,5-dimethylpiperazine (PubChem CID 170290356) has the molecular formula C8H17IN2 and a molecular weight of 268.14 g/mol. Its IUPAC name is (2S,5R)-2-ethyl-1-iodo-4,5-dimethylpiperazine.
| Compound Name | (2S,5R)-2-ethyl-1-iodo-4,5-dimethylpiperazine |
|---|---|
| PubChem CID | 170290356 |
| Molecular Formula | C8H17IN2 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (2S,5R)-2-ethyl-1-iodo-4,5-dimethylpiperazine |
| SMILES | CC[C@H]1CN(C)[C@H](C)CN1I |
| InChI | InChI=1S/C8H17IN2/c1-4-8-6-10(3)7(2)5-11(8)9/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | NFBZNCWYBPXYOO-SFYZADRCSA-N |
| XLogP | 1.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|