C14H27NO — CID 170293881
1-[5-methyl-2,3-di(propan-2-yl)piperidin-1-yl]ethanone (PubChem CID 170293881) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-[5-methyl-2,3-di(propan-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[5-methyl-2,3-di(propan-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170293881 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 1-[5-methyl-2,3-di(propan-2-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C)CC(C(C)C)C1C(C)C |
| InChI | InChI=1S/C14H27NO/c1-9(2)13-7-11(5)8-15(12(6)16)14(13)10(3)4/h9-11,13-14H,7-8H2,1-6H3 |
| InChIKey | YFUXGPFDOAIIRK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |