C32H53NO3 — CID 170306046
1-(3-ethyl-3-methoxypiperidin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one (PubChem CID 170306046) has the molecular formula C32H53NO3 and a molecular weight of 499.78 g/mol. Its IUPAC name is 1-(3-ethyl-3-methoxypiperidin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one.
| Compound Name | 1-(3-ethyl-3-methoxypiperidin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
|---|---|
| PubChem CID | 170306046 |
| Molecular Formula | C32H53NO3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.40 |
| IUPAC Name | 1-(3-ethyl-3-methoxypiperidin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
| SMILES | CCC1(OC)CCCN(C(=O)CCC(C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)C1 |
| InChI | InChI=1S/C32H53NO3/c1-6-32(36-5)16-7-19-33(21-32)29(35)13-8-22(2)26-11-12-27-25-10-9-23-20-24(34)14-17-30(23,3)28(25)15-18-31(26,27)4/h9,22,24-28,34H,6-8,10-21H2,1-5H3/t22?,24-,25-,26+,27-,28-,30-,31+,32?/m0/s1 |
| InChIKey | OTXXDGJTOZPQFQ-NZPVWIMCSA-N |
| XLogP | 6.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|