C17H22O4S — CID 170316883
2-[(1-ethenyl-2-oxabicyclo[2.2.2]octan-4-yl)methyl]-4-methylbenzenesulfonic acid (PubChem CID 170316883) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-[(1-ethenyl-2-oxabicyclo[2.2.2]octan-4-yl)methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[(1-ethenyl-2-oxabicyclo[2.2.2]octan-4-yl)methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 170316883 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(1-ethenyl-2-oxabicyclo[2.2.2]octan-4-yl)methyl]-4-methylbenzenesulfonic acid |
| SMILES | C=CC12CCC(Cc3cc(C)ccc3S(=O)(=O)O)(CC1)CO2 |
| InChI | InChI=1S/C17H22O4S/c1-3-17-8-6-16(7-9-17,12-21-17)11-14-10-13(2)4-5-15(14)22(18,19)20/h3-5,10H,1,6-9,11-12H2,2H3,(H,18,19,20) |
| InChIKey | YMHHNZKZDNLNJS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|