C24H30O7S2 — CID 172692128
2-[[4-ethenyl-4-hydroxy-1-[(5-methyl-2-sulfophenyl)methyl]cyclohexyl]methyl]-4-methylbenzenesulfonic acid (PubChem CID 172692128) has the molecular formula C24H30O7S2 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-[[4-ethenyl-4-hydroxy-1-[(5-methyl-2-sulfophenyl)methyl]cyclohexyl]methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[[4-ethenyl-4-hydroxy-1-[(5-methyl-2-sulfophenyl)methyl]cyclohexyl]methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 172692128 |
| Molecular Formula | C24H30O7S2 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[[4-ethenyl-4-hydroxy-1-[(5-methyl-2-sulfophenyl)methyl]cyclohexyl]methyl]-4-methylbenzenesulfonic acid |
| SMILES | C=CC1(O)CCC(Cc2cc(C)ccc2S(=O)(=O)O)(Cc2cc(C)ccc2S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C24H30O7S2/c1-4-24(25)11-9-23(10-12-24,15-19-13-17(2)5-7-21(19)32(26,27)28)16-20-14-18(3)6-8-22(20)33(29,30)31/h4-8,13-14,25H,1,9-12,15-16H2,2-3H3,(H,26,27,28)(H,29,30,31) |
| InChIKey | BUZWPMLVVLLSPJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|