C8H17N3O — CID 170317022
1-(5-amino-1,5-diazocan-1-yl)ethanone (PubChem CID 170317022) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(5-amino-1,5-diazocan-1-yl)ethanone.
| Compound Name | 1-(5-amino-1,5-diazocan-1-yl)ethanone |
|---|---|
| PubChem CID | 170317022 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1-(5-amino-1,5-diazocan-1-yl)ethanone |
| SMILES | CC(=O)N1CCCN(N)CCC1 |
| InChI | InChI=1S/C8H17N3O/c1-8(12)10-4-2-6-11(9)7-3-5-10/h2-7,9H2,1H3 |
| InChIKey | SESVDGLRWBSLHU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|