C16H18BrF2NO3 — CID 170324329
tert-butyl 2-(5-bromo-4,7-difluoro-3,3-dimethyl-2-oxoindol-1-yl)acetate (PubChem CID 170324329) has the molecular formula C16H18BrF2NO3 and a molecular weight of 390.22 g/mol. Its IUPAC name is tert-butyl 2-(5-bromo-4,7-difluoro-3,3-dimethyl-2-oxoindol-1-yl)acetate.
| Compound Name | tert-butyl 2-(5-bromo-4,7-difluoro-3,3-dimethyl-2-oxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 170324329 |
| Molecular Formula | C16H18BrF2NO3 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | tert-butyl 2-(5-bromo-4,7-difluoro-3,3-dimethyl-2-oxoindol-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C(C)(C)c2c(F)c(Br)cc(F)c21 |
| InChI | InChI=1S/C16H18BrF2NO3/c1-15(2,3)23-10(21)7-20-13-9(18)6-8(17)12(19)11(13)16(4,5)14(20)22/h6H,7H2,1-5H3 |
| InChIKey | QEZQUMMLQLKXCM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|